Vasopressin Molecule

From GM-RKB
(Redirected from Antidiuretic Hormone)
Jump to navigation Jump to search

A Vasopressin Molecule is a neurotransmitter that ...



References

2022

  1. ↑ Cite error: Invalid <ref> tag; no text was provided for refs named isbn0-387-30348-0
  2. ↑ Cite error: Invalid <ref> tag; no text was provided for refs named babar2013

2013


2022

  • (Wikipedia, 2022) ⇒ https://en.wikipedia.org/wiki/Vasopressin Retrieved:2022-9-15.
    • {{drugbox

      | Watchedfields = changed

      | verifiedrevid =

      | drug_name =

      | IUPAC_name = 1-{[(4R,7S,10S,13S,16S,19R)-19-Amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-p rolyl-L-arginylglycinamide

      | synonyms= Antidiuretic hormone (ADH); arginine vasopressin (AVP); argipressin

      | image = Vasopressin_labeled.png

      | width = 250px

      | image2 = Arginine_vasopressin3d.png

      | pronounce = | source_tissues = Supraoptic nucleus; paraventricular nucleus of hypothalamus

      | target_tissues = System-wide

      | receptors = V1A, V1B, V2, OXTR

      | agonists = Felypressin, desmopressin

      | antagonists = Diuretics

      | bioavailability =

      | protein_bound = 1%

      | metabolism = Predominantly in the liver and kidneys

      | elimination_half-life = 10–20 minutes

      | excretion = Urine

      | ATC_prefix = H01

      | ATC_suffix = BA01

      | IUPHAR_ligand = 2168

      | CAS_number_Ref = | CAS_number = 11000-17-2

      | PubChem = 644077

      | DrugBank_Ref = | DrugBank = DB00067

      | ChemSpiderID_Ref = | ChemSpiderID = 559126

      | UNII_Ref = | UNII = Y87Y826H08

      | KEGG_Ref = | KEGG = D00101

      | ChEBI_Ref = | ChEBI = 9937

      | ChEMBL_Ref = | ChEMBL = 373742

      | PDB_ligand =

      | C=46 | H=65 | N=15 | O=12 | S=2

      | molecular_weight =

      | SMILES = c1ccc(cc1)C[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)N2)Cc3ccc(cc3)O)N)C(=O)N4CCC[C@H]4C(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)N)CC(=O)N)CCC(=O)N

      | StdInChI_Ref = | StdInChI = 1S/C46H65N15O12S2

      /c47-27-22-74-75-23-33(45(73)61-17-5-9-34(61)44(72)56-28(8-4-16-53-46(51)52)39(67)54-21-37(50)65)60-43(71)32(20-36(49)64)59-40(68)29(14-15-35(48)63)55-41(69)31(18-24-6-2-1-3-7-24)58-42(70)30(57-38(27)66)19-25-10-12-26(62)13-11-25/h1-3,6-7,10-13,27-34,62H,4-5,8-9,14-23,47H2,(H2,48,63)(H2,49,64)(H2,50,65)(H,54,67)(H,55,69)(H,56,72)(H,57,66)(H,58,70)(H,59,68)(H,60,71)(H4,51,52,53)/t27-,28-,29-,30-,31-,32-,33-,34-/m0/s1

      | StdInChIKey_Ref = | StdInChIKey = KBZOIRJILGZLEJ-LGYYRGKSSA-N

      | density = 1.6±0.1

      |alt=|caption=|type=|MedlinePlus=|legal_status=|licence_EU=|pregnancy_AU=|pregnancy_US=|pregnancy_category=|licence_US=}}

      Human vasopressin, also called antidiuretic hormone (ADH), arginine vasopressin (AVP) or argipressin, is a hormone synthesized from the AVP gene as a peptide prohormone in neurons in the hypothalamus, and is converted to AVP. It then travels down the axon terminating in the posterior pituitary, and is released from vesicles into the circulation in response to extracellular fluid hypertonicity (hyperosmolality). AVP has two primary functions. First, it increases the amount of solute-free water reabsorbed back into the circulation from the filtrate in the kidney tubules of the nephrons. Second, AVP constricts arterioles, which increases peripheral vascular resistance and raises arterial blood pressure. [1]

      A third function is possible. Some AVP may be released directly into the brain from the hypothalamus, and may play an important role in social behavior, sexual motivation and pair bonding, and maternal responses to stress. Vasopressin induces differentiation of stem cells into cardiomyocytes and promotes heart muscle homeostasis.

      It has a very short half-life, between 16 and 24 minutes.[2]

  1. ↑ Cite error: Invalid <ref> tag; no text was provided for refs named isbn0-387-30348-0
  2. ↑ Cite error: Invalid <ref> tag; no text was provided for refs named babar2013